EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:177018 - 3-amino-2-naphthoic acid
| Formula | C11H9NO2 |
| Net Charge | 0 |
| Average Mass | 187.198 |
| Monoisotopic Mass | 187.06333 |
| SMILES | Nc1cc2ccccc2cc1C(=O)O |
| InChI | InChI=1S/C11H9NO2/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6H,12H2,(H,13,14) |
| InChIKey | XFXOLBNQYFRSLQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | Article | ||
| blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-2-naphthoic acid (CHEBI:177018) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 3-aminonaphthalene-2-carboxylic acid |