EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O3 |
| Net Charge | 0 |
| Average Mass | 258.402 |
| Monoisotopic Mass | 258.21949 |
| SMILES | CCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C15H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18/h14,16H,2-13H2,1H3,(H,17,18) |
| InChIKey | ATMSEJBABXCWDW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-pentadecanoic acid (CHEBI:176993) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 3-hydroxypentadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 158374 | ChemSpider |
| HMDB0061657 | HMDB |
| LMFA01050183 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:32602-70-3 | ChemIDplus |