EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H][C@]12N3CC=C[C@@]1(CC)CC(C(=O)OC)=C1Nc4cc(O)ccc4[C@@]12CC3 |
| InChI | InChI=1S/C21H24N2O3/c1-3-20-7-4-9-23-10-8-21(19(20)23)15-6-5-13(24)11-16(15)22-17(21)14(12-20)18(25)26-2/h4-7,11,19,22,24H,3,8-10,12H2,1-2H3/t19-,20-,21-/m0/s1 |
| InChIKey | FXUFRJQCBVSCRZ-ACRUOGEOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-hydroxytabersonine (CHEBI:17699) has functional parent tabersonine (CHEBI:16776) |
| 16-hydroxytabersonine (CHEBI:17699) is a methyl ester (CHEBI:25248) |
| 16-hydroxytabersonine (CHEBI:17699) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| 16-hydroxytabersonine (CHEBI:17699) is a organic heteropentacyclic compound (CHEBI:38164) |
| 16-hydroxytabersonine (CHEBI:17699) is conjugate base of 16-hydroxytabersoninium (CHEBI:58239) |
| Incoming Relation(s) |
| (3R)-1,2-didehydro-3-hydroxy-16-methoxy-2,3-dihydrotabersonine (CHEBI:137485) has functional parent 16-hydroxytabersonine (CHEBI:17699) |
| 16-hydroxytabersoninium (CHEBI:58239) is conjugate acid of 16-hydroxytabersonine (CHEBI:17699) |
| IUPAC Name |
|---|
| methyl 16-hydroxy-2,3,6,7-tetradehydro-5α,12β,19α-aspidospermidine-3-carboxylate |
| Synonym | Source |
|---|---|
| 16-Hydroxytabersonine | KEGG COMPOUND |