EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H75O13P |
| Net Charge | 0 |
| Average Mass | 867.067 |
| Monoisotopic Mass | 866.49453 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\C/C=C\CCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C46H75O13P/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-40(48)58-38(37-57-60(54,55)59-46-44(52)42(50)41(49)43(51)45(46)53)36-56-39(47)34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h5,7,10-13,16-19,21,23,27,29,38,41-46,49-53H,3-4,6,8-9,14-15,20,22,24-26,28,30-37H2,1-2H3,(H,54,55)/b7-5-,12-10-,13-11-,18-16-,19-17-,23-21-,29-27-/t38-,41?,42-,43?,44?,45?,46?/m1/s1 |
| InChIKey | GWPGHNOXVCNIHT-FJSXWZPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PI(17:2(9Z,12Z)/20:5(5Z,8Z,11Z,14Z,17Z)) (CHEBI:176982) is a phosphatidyl-L-serine (CHEBI:18303) |
| IUPAC Name |
|---|
| [(2R)-1-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxy-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropan-2-yl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| Manual Xrefs | Databases |
|---|---|
| LMGP06010269 | LIPID MAPS |