EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H43N7O3 |
| Net Charge | 0 |
| Average Mass | 585.753 |
| Monoisotopic Mass | 585.34274 |
| SMILES | C[C@@H](c1cnc2ccccc12)[C@@H](NC(=O)N1CCC(n2c(=O)nc3ccccc32)CC1)C(=O)NC[C@@H]1CCC[C@H](CN)C1 |
| InChI | InChI=1S/C33H43N7O3/c1-21(26-20-35-27-10-3-2-9-25(26)27)30(31(41)36-19-23-8-6-7-22(17-23)18-34)38-32(42)39-15-13-24(14-16-39)40-29-12-5-4-11-28(29)37-33(40)43/h2-5,9-12,20-24,30,35H,6-8,13-19,34H2,1H3,(H,36,41)(H,37,43)(H,38,42)/t21-,22-,23+,30+/m0/s1 |
| InChIKey | DDVPVAOEMZRZQU-CXDLDTBJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | somatostatin receptor agonist An agonist that binds to and activates somatostatin receptors. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-779976 (CHEBI:176977) has role neuroprotective agent (CHEBI:63726) |
| L-779976 (CHEBI:176977) has role somatostatin receptor agonist (CHEBI:177023) |
| L-779976 (CHEBI:176977) is a benzimidazoles (CHEBI:22715) |
| L-779976 (CHEBI:176977) is a indoles (CHEBI:24828) |
| L-779976 (CHEBI:176977) is a piperidinecarboxamide (CHEBI:48592) |
| L-779976 (CHEBI:176977) is a primary amino compound (CHEBI:50994) |
| L-779976 (CHEBI:176977) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (βS)-N-{[(1R,3S)-3-(aminomethyl)cyclohexyl]methyl}-β-methyl-Nα-{[4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidin-1-yl]carbonyl}-D-tryptophanamide |
| Synonyms | Source |
|---|---|
| L779976 | ChemIDplus |
| L 779,976 | ChemIDplus |
| L 779976 | ChemIDplus |
| L-779,976 | ChEBI |
| N-[(2R,3S)-1-({[(1R,3S)-3-(aminomethyl)cyclohexyl]methyl}amino)-3-(1H-indol-3-yl)-1-oxobutan-2-yl]-4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidine-1-carboxamide | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 8048835 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:214770-19-1 | ChemIDplus |
| Citations |
|---|