EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | CC(=O)NCCc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15) |
| InChIKey | MVAWJSIDNICKHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). tropomyosin-related kinase B receptor agonist An agonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylserotonin (CHEBI:17697) has role antioxidant (CHEBI:22586) |
| N-acetylserotonin (CHEBI:17697) has role human metabolite (CHEBI:77746) |
| N-acetylserotonin (CHEBI:17697) has role mouse metabolite (CHEBI:75771) |
| N-acetylserotonin (CHEBI:17697) has role tropomyosin-related kinase B receptor agonist (CHEBI:140489) |
| N-acetylserotonin (CHEBI:17697) is a N-acylserotonin (CHEBI:134175) |
| N-acetylserotonin (CHEBI:17697) is a acetamides (CHEBI:22160) |
| N-acetylserotonin (CHEBI:17697) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]acetamide |
| Synonyms | Source |
|---|---|
| N-(2-(5-Hydroxy-1H-indol-3-yl)ethyl)acetamide | ChemIDplus |
| N-Acetyl-5-hydroxytryptamine | KEGG COMPOUND |
| N-Acetylserotonin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| N-acetylserotonin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| ASE | PDBeChem |
| C00978 | KEGG COMPOUND |
| DB04275 | DrugBank |
| HMDB0001238 | HMDB |
| LSM-20977 | LINCS |
| N-acetyl-serotonin | Wikipedia |
| N-ACETYL-SEROTONIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:479159 | Reaxys |
| CAS:1210-83-9 | ChemIDplus |
| CAS:1210-83-9 | KEGG COMPOUND |
| Citations |
|---|