EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176968 - 7-Oxo-11-Dodecenoic acid
| Formula | C12H20O3 |
| Net Charge | 0 |
| Average Mass | 212.289 |
| Monoisotopic Mass | 212.14124 |
| SMILES | C=CCCCC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C12H20O3/c1-2-3-5-8-11(13)9-6-4-7-10-12(14)15/h2H,1,3-10H2,(H,14,15) |
| InChIKey | CDSFEDLMFNBDBT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | blood serum (BTO:0000133) | Article | Strain: Wistar Unilever, Rat Strain [THESAURUS.OWL#C76193] |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Oxo-11-Dodecenoic acid (CHEBI:176968) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 7-oxododec-11-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 3576401 | ChemSpider |
| LMFA01060182 | LIPID MAPS |