EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O4 |
| Net Charge | 0 |
| Average Mass | 312.450 |
| Monoisotopic Mass | 312.23006 |
| SMILES | O=C(O)CCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O4/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22/h1-2H,3-16H2,(H,19,20)(H,21,22)/b2-1- |
| InChIKey | SBLKVIQSIHEQOF-UPHRSURJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Octadec-9-ene-1,18-dioic-acid (CHEBI:176959) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (Z)-octadec-9-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822624 | ChemSpider |
| C19618 | KEGG COMPOUND |
| LMFA01170055 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:20701-68-2 | ChemIDplus |