EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H34N4O4.Mg |
| Net Charge | 0 |
| Average Mass | 574.964 |
| Monoisotopic Mass | 574.24305 |
| SMILES | CCC1=C(C)c2cc3[n-]c(cc4nc(c5c6[n-]c(cc1n2)c(C)c6C(=O)C5)[C@@H](CCC(=O)O)[C@@H]4C)c(C)c3C(C)O.[Mg+2] |
| InChI | InChI=1S/C33H36N4O4.Mg/c1-7-19-14(2)22-13-27-30(18(6)38)16(4)24(35-27)11-23-15(3)20(8-9-29(40)41)32(36-23)21-10-28(39)31-17(5)25(37-33(21)31)12-26(19)34-22;/h11-13,15,18,20,38H,7-10H2,1-6H3,(H3,34,35,36,37,39,40,41);/q;+2/p-2/t15-,18?,20-;/m0./s1 |
| InChIKey | NLKXTSVNFLJGKK-TTWAWOKTSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Ethyl-12-methylbacteriochlorophyllide d (CHEBI:176951) is a chlorins (CHEBI:33910) |
| IUPAC Name |
|---|
| magnesium;3-[(21S,22S)-11-ethyl-16-(1-hydroxyethyl)-12,17,21,26-tetramethyl-4-oxo-23,25-diaza-7,24-diazanidahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23)-decaen-22-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C21431 | KEGG COMPOUND |