EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H33NO2 |
| Net Charge | 0 |
| Average Mass | 307.478 |
| Monoisotopic Mass | 307.25113 |
| SMILES | CC[C@H](O)/C(C)=C/CC(C)/C=C1\CN2CCCC2[C@@](C)(O)C1 |
| InChI | InChI=1S/C19H33NO2/c1-5-17(21)15(3)9-8-14(2)11-16-12-19(4,22)18-7-6-10-20(18)13-16/h9,11,14,17-18,21-22H,5-8,10,12-13H2,1-4H3/b15-9+,16-11-/t14?,17-,18?,19-/m0/s1 |
| InChIKey | CUBVJLHFQCEJGM-BQAOJKSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pumiliotoxin A (CHEBI:176949) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6Z,8S)-6-[(E,6S)-6-hydroxy-2,5-dimethyloct-4-enylidene]-8-methyl-1,2,3,5,7,8a-hexahydroindolizin-8-ol |
| Manual Xrefs | Databases |
|---|---|
| 4939785 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:67054-00-6 | ChemIDplus |