EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176940 - L-Alanyl-gamma-D-glutamyl-L-lysine
| Formula | C14H26N4O6 |
| Net Charge | 0 |
| Average Mass | 346.384 |
| Monoisotopic Mass | 346.18523 |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)N[C@@H](CCCCN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26N4O6/c1-8(16)12(20)18-10(14(23)24)5-6-11(19)17-9(13(21)22)4-2-3-7-15/h8-10H,2-7,15-16H2,1H3,(H,17,19)(H,18,20)(H,21,22)(H,23,24)/t8-,9-,10+/m0/s1 |
| InChIKey | IXJJWFQIGFGEEO-LPEHRKFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Alanyl-gamma-D-glutamyl-L-lysine (CHEBI:176940) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-6-amino-2-[[(4R)-4-[[(2S)-2-aminopropanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |