EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31N3O11S2 |
| Net Charge | 0 |
| Average Mass | 553.612 |
| Monoisotopic Mass | 553.14000 |
| SMILES | [H][C@@]1([C@H](C)OS(=O)(=O)O)C(=O)N2C(C(=O)O)=C(SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO)C[C@@]21[H] |
| InChI | InChI=1S/C20H31N3O11S2/c1-10(34-36(31,32)33)14-11-8-12(15(19(29)30)23(11)18(14)28)35-7-6-21-13(25)4-5-22-17(27)16(26)20(2,3)9-24/h10-11,14,16,24,26H,4-9H2,1-3H3,(H,21,25)(H,22,27)(H,29,30)(H,31,32,33)/t10-,11+,14-,16-/m0/s1 |
| InChIKey | GRWWKENHBQJAML-VAECKANCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OA-6129 C (CHEBI:176934) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| (5R,6R)-3-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulanyl]-7-oxo-6-[(1S)-1-sulooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C20814 | KEGG COMPOUND |