EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176930 - Carbapenem biosynthesis intermediate 6
| Formula | C8H9NO3 |
| Net Charge | 0 |
| Average Mass | 167.164 |
| Monoisotopic Mass | 167.05824 |
| SMILES | CC1C(=O)N2C(C(=O)O)=CCC12 |
| InChI | InChI=1S/C8H9NO3/c1-4-5-2-3-6(8(11)12)9(5)7(4)10/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | ASNMOVGFVCNQKX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carbapenem biosynthesis intermediate 6 (CHEBI:176930) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| 6-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |