EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O10 |
| Net Charge | 0 |
| Average Mass | 530.570 |
| Monoisotopic Mass | 530.21520 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c3cc4c(c1OCC(C)C(C)(O)C(=O)OC2C(C)(O)C(C)C3)OCO4 |
| InChI | InChI=1S/C28H34O10/c1-13-8-15-9-18-22(37-12-36-18)24-19(15)20-16(10-17(32-5)21(33-6)23(20)34-7)25(27(13,3)30)38-26(29)28(4,31)14(2)11-35-24/h9-10,13-14,25,30-31H,8,11-12H2,1-7H3 |
| InChIKey | VLLFEMVDMFTBHG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gomisin D (CHEBI:176928) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 12,25-dihydroxy-18,19,20-trimethoxy-11,12,24,25-tetramethyl-4,6,9,14-tetraoxapentacyclo[13.7.3.03,7.08,22.016,21]pentacosa-1,3(7),8(22),16,18,20-hexaen-13-one |
| Manual Xrefs | Databases |
|---|---|
| 44210490 | ChemSpider |