EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176926 - Azatyrosine
| Formula | C8H10N2O3 |
| Net Charge | 0 |
| Average Mass | 182.179 |
| Monoisotopic Mass | 182.06914 |
| SMILES | N[C@@H](Cc1ccc(O)cn1)C(=O)O |
| InChI | InChI=1S/C8H10N2O3/c9-7(8(12)13)3-5-1-2-6(11)4-10-5/h1-2,4,7,11H,3,9H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | YOZSEGPJAXTSFZ-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptococcus mutans (ncbitaxon:1309) | biofilm (BTO:0002690) | MetaboLights (MTBLS3020) | Strain: Streptococcus mutans UA159 [NCBI:txid210007] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Azatyrosine (CHEBI:176926) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(5-hydroxypyridin-2-yl)propanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:58525-82-9 | ChemIDplus |