EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O6 |
| Net Charge | 0 |
| Average Mass | 200.146 |
| Monoisotopic Mass | 200.03209 |
| SMILES | O=C(O)C1=C[C@@H](O)[C@@H](O)C=C1C(=O)O |
| InChI | InChI=1S/C8H8O6/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2,5-6,9-10H,(H,11,12)(H,13,14)/t5-,6+ |
| InChIKey | MFSRJRFDIILHFC-OLQVQODUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4,5-dihydroxycyclohexa-2,6-diene-1,2-dicarboxylic acid (CHEBI:17692) is a cyclohexadienedicarboxylic acid (CHEBI:36194) |
| cis-4,5-dihydroxycyclohexa-2,6-diene-1,2-dicarboxylic acid (CHEBI:17692) is conjugate acid of cis-4,5-dihydroxycyclohexa-2,6-diene-1,2-dicarboxylate(2−) (CHEBI:58237) |
| Incoming Relation(s) |
| cis-4,5-dihydroxycyclohexa-2,6-diene-1,2-dicarboxylate(2−) (CHEBI:58237) is conjugate base of cis-4,5-dihydroxycyclohexa-2,6-diene-1,2-dicarboxylic acid (CHEBI:17692) |
| IUPAC Name |
|---|
| rel-(4R,5S)-4,5-dihydroxycyclohexa-2,6-diene-1,2-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| cis-4,5-Dihydroxycyclohexa-1(6),2-diene-1,2-dicarboxylate | KEGG COMPOUND |
| Phthalate-4,5-cis-dihydrodiol | KEGG COMPOUND |