EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO2 |
| Net Charge | 0 |
| Average Mass | 163.176 |
| Monoisotopic Mass | 163.06333 |
| SMILES | O=C(O)[C@H]1NCc2ccccc21 |
| InChI | InChI=1S/C9H9NO2/c11-9(12)8-7-4-2-1-3-6(7)5-10-8/h1-4,8,10H,5H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | OFKFBEJYOHXPIA-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-isoindoline-1-carboxylic acid (CHEBI:176912) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| (1S)-2,3-dihydro-1H-isoindole-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| Disc | ChEBI |
| (1,3)-dihydro-2H-isoindole-(S)-2-carboxylic acid | ChEBI |
| Citations |
|---|