EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO5 |
| Net Charge | 0 |
| Average Mass | 251.238 |
| Monoisotopic Mass | 251.07937 |
| SMILES | COc1cc(/C=C/C(=O)NCC(=O)O)ccc1O |
| InChI | InChI=1S/C12H13NO5/c1-18-10-6-8(2-4-9(10)14)3-5-11(15)13-7-12(16)17/h2-6,14H,7H2,1H3,(H,13,15)(H,16,17)/b5-3+ |
| InChIKey | CLGNQAIRBLDHIN-HWKANZROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-feruloylglycine (CHEBI:17691) is a N-acylglycine (CHEBI:16180) |
| N-feruloylglycine (CHEBI:17691) is conjugate acid of N-feruloylglycinate (CHEBI:58236) |
| Incoming Relation(s) |
| N-feruloylglycinate (CHEBI:58236) is conjugate base of N-feruloylglycine (CHEBI:17691) |
| IUPAC Names |
|---|
| {[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino}acetic acid |
| N-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]glycine |
| Synonym | Source |
|---|---|
| N-Feruloylglycine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02564 | KEGG COMPOUND |