EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10F6N4 |
| Net Charge | 0 |
| Average Mass | 384.283 |
| Monoisotopic Mass | 384.08097 |
| SMILES | Fc1cccc(C(F)(F)F)c1Cn1ccc(/N=N\c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C17H10F6N4/c18-12-4-1-3-11(17(21,22)23)10(12)9-27-8-7-15(26-27)24-25-16-13(19)5-2-6-14(16)20/h1-8H,9H2/b25-24- |
| InChIKey | TXWNZTPRPAPHSE-IZHYLOQSSA-N |
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-piCRAC-1 (CHEBI:176909) is a piCRAC-1 (CHEBI:176898) |
| IUPAC Name |
|---|
| 3-[(Z)-(2,6-difluorophenyl)diazenyl]-1-[2-fluoro-6-(trifluoromethyl)benzyl]-1H-pyrazole |
| Synonyms | Source |
|---|---|
| 3-[(Z)-(2,6-difluorophenyl)diazenyl]-1-{[2-fluoro-6-(trifluoromethyl)phenyl]methyl}-1H-pyrazole | IUPAC |
| (Z)-piCRAC-1 | ChEBI |
| Citations |
|---|