EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O6 |
| Net Charge | 0 |
| Average Mass | 508.740 |
| Monoisotopic Mass | 508.37639 |
| SMILES | [H][C@@]12C[C@@H](OC(C)=O)[C@@]3(O)C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H](O)CC(C)(O)C(C)C |
| InChI | InChI=1S/C30H52O6/c1-17(2)29(7,34)16-25(33)18(3)22-8-9-23-21-14-26(36-19(4)31)30(35)15-20(32)10-13-28(30,6)24(21)11-12-27(22,23)5/h17-18,20-26,32-35H,8-16H2,1-7H3/t18-,20-,21-,22+,23-,24-,25+,26+,27+,28+,29?,30-/m0/s1 |
| InChIKey | DSWIQYPNVUWDSX-HRVLZDRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma congolense (ncbitaxon:5692) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2372) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6beta-acetoxy-24-methylcholestan-3beta,5alpha,22R,24-tetrol (CHEBI:176867) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| [(3S,5R,6R,8S,9S,10R,13S,14S,17R)-17-[(2S,3R)-3,5-dihydroxy-5,6-dimethylheptan-2-yl]-3,5-dihydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 112075 | ChemSpider |
| LMST01031065 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:96736-31-1 | ChemIDplus |