EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O3 |
| Net Charge | 0 |
| Average Mass | 424.625 |
| Monoisotopic Mass | 424.29775 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/C=C/C=C/CO)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C28H40O3/c1-20(10-7-5-4-6-8-17-29)25-14-15-26-22(11-9-16-28(25,26)3)12-13-23-18-24(30)19-27(31)21(23)2/h4-8,10,12-13,20,24-27,29-31H,2,9,11,14-19H2,1,3H3/b5-4+,8-6+,10-7+,22-12+,23-13-/t20-,24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | DHSBJCJEENJGKO-QDVNLBANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma congolense (ncbitaxon:5692) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2372) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,7E,22E,24E,26E)-(1S,3R)-26a,26b-dihomo-27-nor-9,10-seco-5,7,10(19),22,24,26(26a)-cholestahexaene-1,3,26b-triol (CHEBI:176865) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,3E,5E,7E)-9-hydroxynona-3,5,7-trien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826400 | ChemSpider |
| LMST03020312 | LIPID MAPS |