EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21BrO2 |
| Net Charge | 0 |
| Average Mass | 265.191 |
| Monoisotopic Mass | 264.07249 |
| SMILES | O=C(O)CCCCCCCCCCBr |
| InChI | InChI=1S/C11H21BrO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-10H2,(H,13,14) |
| InChIKey | IUDGNRWYNOEIKF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma congolense (ncbitaxon:5692) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2372) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-bromo-undecanoic acid (CHEBI:176862) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 11-bromoundecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16831 | ChemSpider |
| LMFA01090005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2834-05-1 | ChemIDplus |