EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O3 |
| Net Charge | 0 |
| Average Mass | 146.186 |
| Monoisotopic Mass | 146.09429 |
| SMILES | CCOC(=O)[C@H](C)[C@H](C)O |
| InChI | InChI=1S/C7H14O3/c1-4-10-7(9)5(2)6(3)8/h5-6,8H,4H2,1-3H3/t5-,6+/m1/s1 |
| InChIKey | BZFWGBFTIQSEBN-RITPCOANSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma congolense (ncbitaxon:5692) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2372) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl-(2R)-methyl-(3S)-hydroxybutanoate (CHEBI:176858) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| ethyl (2R,3S)-3-hydroxy-2-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| 557817 | ChemSpider |