EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O2 |
| Net Charge | 0 |
| Average Mass | 126.155 |
| Monoisotopic Mass | 126.06808 |
| SMILES | O=C(O)CC1C=CCC1 |
| InChI | InChI=1S/C7H10O2/c8-7(9)5-6-3-1-2-4-6/h1,3,6H,2,4-5H2,(H,8,9) |
| InChIKey | NNRZTJAACCRFRV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma congolense (ncbitaxon:5692) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS2372) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-cyclopentenyl)-ethanoic acid (CHEBI:176857) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-cyclopent-2-en-1-ylacetic acid |
| Manual Xrefs | Databases |
|---|---|
| 86857 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13668-61-6 | ChemIDplus |