EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O3 |
| Net Charge | 0 |
| Average Mass | 340.423 |
| Monoisotopic Mass | 340.17869 |
| SMILES | [H][C@@]1([C@H](O)c2ccnc3ccc(OC)cc23)C[C@@H]2CC[N@@]1C[C@]2(O)C=C |
| InChI | InChI=1S/C20H24N2O3/c1-3-20(24)12-22-9-7-13(20)10-18(22)19(23)15-6-8-21-17-5-4-14(25-2)11-16(15)17/h3-6,8,11,13,18-19,23-24H,1,7,9-10,12H2,2H3/t13-,18-,19+,20+/m0/s1 |
| InChIKey | BSRUJCFCZKMFMB-YGHPHNMRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyquinine (CHEBI:17685) has functional parent quinine (CHEBI:15854) |
| 3-hydroxyquinine (CHEBI:17685) has functional parent quinine(1+) (CHEBI:137041) |
| 3-hydroxyquinine (CHEBI:17685) is a cinchona alkaloid (CHEBI:51323) |
| 3-hydroxyquinine (CHEBI:17685) is conjugate base of 3-hydroxyquininium (CHEBI:58234) |
| Incoming Relation(s) |
| 3-hydroxyquininium (CHEBI:58234) is conjugate acid of 3-hydroxyquinine (CHEBI:17685) |
| IUPAC Name |
|---|
| (8α,9R)-6'-methoxycinchonan-3,9-diol |
| Synonym | Source |
|---|---|
| 3-Hydroxyquinine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07344 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:94386 | Beilstein |
| CAS:78549-61-8 | KEGG COMPOUND |