EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| InChIKey | ISAOCJYIOMOJEB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoin (CHEBI:17682) has role EC 3.1.1.1 (carboxylesterase) inhibitor (CHEBI:78444) |
| benzoin (CHEBI:17682) is a benzoins (CHEBI:51586) |
| benzoin (CHEBI:17682) is a secondary α-hydroxy ketone (CHEBI:2468) |
| Incoming Relation(s) |
| (R)-benzoin (CHEBI:51509) is a benzoin (CHEBI:17682) |
| (S)-benzoin (CHEBI:51510) is a benzoin (CHEBI:17682) |
| IUPAC Name |
|---|
| 2-hydroxy-1,2-diphenylethanone |
| Synonyms | Source |
|---|---|
| 2-hydroxy-1,2-diphenylethanone | ChEBI |
| 2-Hydroxy-1,2-diphenylethanone | KEGG COMPOUND |
| 2-Hydroxy-2-phenylacetophenone | ChemIDplus |
| alpha-Hydroxy-alpha-phenylacetophenone | ChemIDplus |
| alpha-Hydroxybenzyl phenyl ketone | ChemIDplus |
| Benzoin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| benzoin | UniProt |
| Citations |
|---|