EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CC(C)CCCCCCC(=O)O |
| InChI | InChI=1S/C10H20O2/c1-9(2)7-5-3-4-6-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | OAOABCKPVCUNKO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS2531) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-methyl Nonanoic acid (CHEBI:176811) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 8-methylnonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 100023 | ChemSpider |
| LMFA01020247 | LIPID MAPS |
| T55 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:5963-14-4 | ChemIDplus |