EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 337.375 |
| Monoisotopic Mass | 337.13141 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@]12Cc3ccccc3[C@](C)(N1)c1ccccc12 |
| InChI | InChI=1S/C16H15N.C4H4O4/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16;5-3(6)1-2-4(7)8/h2-9,15,17H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t15-,16+;/m1./s1 |
| InChIKey | QLTXKCWMEZIHBJ-PJGJYSAQSA-N |
| Roles Classification |
|---|
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anaesthetic Substance which produces loss of feeling or sensation. anticonvulsant A drug used to prevent seizures or reduce their severity. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dizocilpine maleate (CHEBI:176788) has part dizocilpine(1+) (CHEBI:176787) |
| dizocilpine maleate (CHEBI:176788) has role anaesthetic (CHEBI:38867) |
| dizocilpine maleate (CHEBI:176788) has role anticonvulsant (CHEBI:35623) |
| dizocilpine maleate (CHEBI:176788) has role neuroprotective agent (CHEBI:63726) |
| dizocilpine maleate (CHEBI:176788) has role nicotinic antagonist (CHEBI:48878) |
| dizocilpine maleate (CHEBI:176788) has role NMDA receptor antagonist (CHEBI:60643) |
| dizocilpine maleate (CHEBI:176788) is a maleate salt (CHEBI:50221) |
| dizocilpine maleate (CHEBI:176788) is a tetracyclic antidepressant (CHEBI:50940) |
| IUPAC Name |
|---|
| (5S,10R)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| MK 801 | ChemIDplus |
| MK-801 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03878 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:77086-22-7 | ChemIDplus |
| Citations |
|---|