EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h3-4H,2,5-7H2,1H3,(H,9,10)/b4-3- |
| InChIKey | RRGOKSYVAZDNKR-ARJAWSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mastigoproctus giganteus (ncbitaxon:58767) | - | PubMed (12770208) | Found in pygidial gland secretions. |
| Vitis vinifera (ncbitaxon:29760) | leaf (BTO:0000713) | MetaboLights (MTBLS2876) |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z)-5-octenoic acid (CHEBI:176781) has role animal metabolite (CHEBI:75767) |
| (5Z)-5-octenoic acid (CHEBI:176781) has role flavouring agent (CHEBI:35617) |
| (5Z)-5-octenoic acid (CHEBI:176781) has role plant metabolite (CHEBI:76924) |
| (5Z)-5-octenoic acid (CHEBI:176781) is a medium-chain fatty acid (CHEBI:59554) |
| (5Z)-5-octenoic acid (CHEBI:176781) is a monounsaturated fatty acid (CHEBI:25413) |
| (5Z)-5-octenoic acid (CHEBI:176781) is a olefinic fatty acid (CHEBI:53339) |
| (5Z)-5-octenoic acid (CHEBI:176781) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| (5Z)-oct-5-enoic acid |
| Synonyms | Source |
|---|---|
| (5Z)-octenoic acid | ChEBI |
| 5Z-octenoic acid | ChEBI |
| FEMA 4350 | ChEBI |
| cis-5-octenoic acid | LIPID MAPS |
| (Z)-5-octenoic acid | ChEBI |
| (Z)-oct-5-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4445845 | ChemSpider |
| FDB006478 | FooDB |
| HMDB0032207 | HMDB |
| LMFA01030022 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:41653-97-8 | ChemIDplus |
| Citations |
|---|