EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O6 |
| Net Charge | 0 |
| Average Mass | 212.157 |
| Monoisotopic Mass | 212.03209 |
| SMILES | COc1cc(C(=O)O)c(O)c2c1OCO2 |
| InChI | InChI=1S/C9H8O6/c1-13-5-2-4(9(11)12)6(10)8-7(5)14-3-15-8/h2,10H,3H2,1H3,(H,11,12) |
| InChIKey | CYZVRAUHGNBXIO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000118) | MetaboLights (MTBLS2262) | ||
| blood plasma (BTO:0000118) | MetaboLights (MTBLS2262) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxy-7-methoxy-1,3-benzodioxole-5-carboxylic acid (CHEBI:176763) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 4-hydroxy-7-methoxy-1,3-benzodioxole-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 3230374 | ChemSpider |
| HMDB0137303 | HMDB |