EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H66O4 |
| Net Charge | 0 |
| Average Mass | 586.942 |
| Monoisotopic Mass | 586.49611 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)/C=C/c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C38H66O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-33-42-38(40)32-30-35-29-31-37(41-2)36(39)34-35/h29-32,34,39H,3-28,33H2,1-2H3/b32-30+ |
| InChIKey | XEOWPOLWKNHXGL-NHQGMKOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000118) | MetaboLights (MTBLS2262) | ||
| blood plasma (BTO:0000118) | MetaboLights (MTBLS2262) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Erythrinasinate A (CHEBI:176710) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| octacosyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 30777289 | ChemSpider |
| HMDB0038713 | HMDB |