EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13N5O2 |
| Net Charge | 0 |
| Average Mass | 283.291 |
| Monoisotopic Mass | 283.10692 |
| SMILES | N#C/C(N)=C(C#N)/N=C/NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H13N5O2/c15-7-11(17)13(8-16)19-9-18-12(14(20)21)6-10-4-2-1-3-5-10/h1-5,9,12H,6,17H2,(H,18,19)(H,20,21)/b13-11- |
| InChIKey | WWXJFLKNBPEVCZ-QBFSEMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine (CHEBI:176673) is a benzenes (CHEBI:22712) |
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine (CHEBI:176673) is a dinitrile (CHEBI:51308) |
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine (CHEBI:176673) is a enamine (CHEBI:47989) |
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine (CHEBI:176673) is a imine (CHEBI:24783) |
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine (CHEBI:176673) is a monocarboxylic acid (CHEBI:25384) |
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine (CHEBI:176673) is a phenylalanine derivative (CHEBI:25985) |
| IUPAC Name |
|---|
| N-[(E)-{[(Z)-2-amino-1,2-dicyanoethenyl]imino}methyl]phenylalanine |
| Synonym | Source |
|---|---|
| 2-[(E)-N'-[(1Z)-2-amino-1,2-dicyanoeth-1-en-1-yl]methanimidamido]-3-phenylpropanoic acid | IUPAC |
| Citations |
|---|