EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O6 |
| Net Charge | 0 |
| Average Mass | 382.412 |
| Monoisotopic Mass | 382.14164 |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H22O6/c1-26-20-11-7-16(13-22(20)28-3)5-9-18(24)14-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h4-13,25H,14H2,1-3H3/b8-4+,9-5+ |
| InChIKey | DQKZBIYOJBTONX-KBXRYBNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1E,6E)-1-(3,4-Dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione (CHEBI:176667) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,6E)-1-(3,4-dimethoxyphenyl)-7-(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 8424798 | ChemSpider |