EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176662 - 1-(4-hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)-1,4-pentadiene-3-one
| Formula | C18H16O4 |
| Net Charge | 0 |
| Average Mass | 296.322 |
| Monoisotopic Mass | 296.10486 |
| SMILES | COc1cc(C=CC(=O)C=Cc2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C18H16O4/c1-22-18-12-14(6-11-17(18)21)5-10-16(20)9-4-13-2-7-15(19)8-3-13/h2-12,19,21H,1H3 |
| InChIKey | QVRYUUYYIWAQHV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)-1,4-pentadiene-3-one (CHEBI:176662) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)penta-1,4-dien-3-one |