EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O4 |
| Net Charge | 0 |
| Average Mass | 420.549 |
| Monoisotopic Mass | 420.23006 |
| SMILES | CCc1cc(C=CC(=O)CC(=O)C=Cc2cc(CC)c(O)c(CC)c2)cc(CC)c1O |
| InChI | InChI=1S/C27H32O4/c1-5-20-13-18(14-21(6-2)26(20)30)9-11-24(28)17-25(29)12-10-19-15-22(7-3)27(31)23(8-4)16-19/h9-16,30-31H,5-8,17H2,1-4H3 |
| InChIKey | BKGPDWNXDNQKBU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-bis(3,5-diethyl-4-hydroxyphenyl)-1,6-heptadiene-3,5-dione (CHEBI:176661) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1,7-bis(3,5-diethyl-4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |