EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O8 |
| Net Charge | 0 |
| Average Mass | 428.437 |
| Monoisotopic Mass | 428.14712 |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2cc(OC)c(O)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C23H24O8/c1-28-18-9-14(10-19(29-2)22(18)26)5-7-16(24)13-17(25)8-6-15-11-20(30-3)23(27)21(12-15)31-4/h5-12,26-27H,13H2,1-4H3 |
| InChIKey | POWBSRUMKJEPOH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,7-bis(4-hydroxy-3,5-dimethoxyphenyl)-1,6-heptadiene-3,5-dione (CHEBI:176658) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1,7-bis(4-hydroxy-3,5-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 352425 | ChemSpider |