EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O5 |
| Net Charge | 0 |
| Average Mass | 324.332 |
| Monoisotopic Mass | 324.09977 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)CC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H16O5/c20-15-6-1-13(2-7-15)3-8-16(21)12-17(22)9-4-14-5-10-18(23)19(24)11-14/h1-11,20,23-24H,12H2/b8-3+,9-4+ |
| InChIKey | YZCBFQDXCIWDOS-BQYBEJQRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3,4-Dihydroxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (CHEBI:176654) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,6E)-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 24660343 | ChemSpider |