EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176652 - tetrahydroxycurcumin
| Formula | C19H16O6 |
| Net Charge | 0 |
| Average Mass | 340.331 |
| Monoisotopic Mass | 340.09469 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)CC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H16O6/c20-14(5-1-12-3-7-16(22)18(24)9-12)11-15(21)6-2-13-4-8-17(23)19(25)10-13/h1-10,22-25H,11H2/b5-1+,6-2+ |
| InChIKey | OJFGQVZAISEIPG-IJIVKGSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydroxycurcumin (CHEBI:176652) has role anti-inflammatory agent (CHEBI:67079) |
| tetrahydroxycurcumin (CHEBI:176652) has role neuroprotective agent (CHEBI:63726) |
| tetrahydroxycurcumin (CHEBI:176652) has role plant metabolite (CHEBI:76924) |
| tetrahydroxycurcumin (CHEBI:176652) is a catechols (CHEBI:33566) |
| tetrahydroxycurcumin (CHEBI:176652) is a diarylheptanoid (CHEBI:78802) |
| tetrahydroxycurcumin (CHEBI:176652) is a enone (CHEBI:51689) |
| tetrahydroxycurcumin (CHEBI:176652) is a polyphenol (CHEBI:26195) |
| tetrahydroxycurcumin (CHEBI:176652) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| (1E,6E)-1,7-bis(3,4-dihydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Synonyms | Source |
|---|---|
| didemethyl curcumin | ChEBI |
| bisdemethylcurcumin | ChEBI |
| (1E,6E)-1,7-bis(3,4-dihydroxyphenyl)-1,6-heptadiene-3,5-dione | ChEBI |
| bis(3,4-dihydroxy-trans-cinnamoyl)methane | ChEBI |
| di-O-demethylcurcumin | ChEBI |
| didemethylcurcumin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4579942 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:60831-46-1 | ChEBI |
| Citations |
|---|