EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:176651 - tetrahydrodemethoxycurcumin
| Formula | C20H22O5 |
| Net Charge | 0 |
| Average Mass | 342.391 |
| Monoisotopic Mass | 342.14672 |
| SMILES | COc1cc(CCC(=O)CC(=O)CCc2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C20H22O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-3,6-8,11-12,21,24H,4-5,9-10,13H2,1H3 |
| InChIKey | HJFYFYWETUVIHT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma zedoaria (ncbitaxon:136224) | rhizome (BTO:0001181) | PubMed (15498665 ) | |
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrodemethoxycurcumin (CHEBI:176651) has role plant metabolite (CHEBI:76924) |
| tetrahydrodemethoxycurcumin (CHEBI:176651) is a diarylheptanoid (CHEBI:78802) |
| tetrahydrodemethoxycurcumin (CHEBI:176651) is a monomethoxybenzene (CHEBI:25235) |
| tetrahydrodemethoxycurcumin (CHEBI:176651) is a polyphenol (CHEBI:26195) |
| tetrahydrodemethoxycurcumin (CHEBI:176651) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-dione |
| Synonyms | Source |
|---|---|
| tetrahydrodemethoxydiferuloylmethane | ChemIDplus |
| demethoxytetrahydrocurcumin | ChemIDplus |
| 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-3,5-heptanedione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8081692 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:149579-07-7 | ChemIDplus |
| Citations |
|---|