EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O5 |
| Net Charge | 0 |
| Average Mass | 352.386 |
| Monoisotopic Mass | 352.13107 |
| SMILES | COc1cc(/C=C/C=C/C(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H20O5/c1-25-20-13-15(8-11-18(20)23)5-3-4-6-17(22)10-7-16-9-12-19(24)21(14-16)26-2/h3-14,23-24H,1-2H3/b5-3+,6-4+,10-7+ |
| InChIKey | JUDCTVXWYFNGQQ-FQXJPFFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curcuma longa (ncbitaxon:136217) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) | |
| Curcuma aromatica (ncbitaxon:136209) | rhizome (BTO:0001181) | MetaboLights (MTBLS2790) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1E,4E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one (CHEBI:176637) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1E,4E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 9079552 | ChemSpider |