EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2[13C2]H7NO4 |
| Net Charge | 0 |
| Average Mass | 135.088 |
| Monoisotopic Mass | 135.04422 |
| SMILES | N[C@H](C[13C](=O)O)[13C](=O)O |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1/i3+1,4+1 |
| InChIKey | CKLJMWTZIZZHCS-JKHYPSIWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-aspartic acid-1,4-13C2 (CHEBI:176632) is a aspartic acid-1,4-13C2 (CHEBI:176633) |
| D-aspartic acid-1,4-13C2 (CHEBI:176632) is enantiomer of L-aspartic acid-1,4-13C2 (CHEBI:176631) |
| Incoming Relation(s) |
| DL-aspartic acid-1,4-13C2 (CHEBI:176585) has part D-aspartic acid-1,4-13C2 (CHEBI:176632) |
| L-aspartic acid-1,4-13C2 (CHEBI:176631) is enantiomer of D-aspartic acid-1,4-13C2 (CHEBI:176632) |
| IUPAC Name |
|---|
| D-(1,4-13C2)aspartic acid |
| Synonym | Source |
|---|---|
| (2R)-2-amino(1,4-13C2)butanedioic acid | IUPAC |