EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O5 |
| Net Charge | 0 |
| Average Mass | 190.195 |
| Monoisotopic Mass | 190.08412 |
| SMILES | C[C@H](CC(=O)O)OC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C8H14O5/c1-5(9)3-8(12)13-6(2)4-7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)/t5-,6-/m1/s1 |
| InChIKey | RILHUWWTCSDPAN-PHDIDXHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Annulohypoxylon truncatum (ncbitaxon:327061) | - | PubMed (14695807) | |
| Linyphia triangularis (ncbitaxon:94031) | - | PubMed (17810206) | |
| Micromonospora sp. RV43 (ncbitaxon:1661387) | - | PubMed (28355070) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) has functional parent butyric acid (CHEBI:30772) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) has role fungal metabolite (CHEBI:76946) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) has role pheromone (CHEBI:26013) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) is a (3R)-3-hydroxybutanoic acid oligomer (CHEBI:140392) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) is a carboxylic ester (CHEBI:33308) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) is conjugate acid of (R)-3-[(R)-3-hydroxybutanoyloxy]butanoate (CHEBI:10979) |
| Incoming Relation(s) |
| (R)-3-[(R)-3-hydroxybutanoyloxy]butanoate (CHEBI:10979) is conjugate base of (R)-3-[(R)-3-hydroxybutanoyloxy]butanoic acid (CHEBI:17663) |
| IUPAC Name |
|---|
| (3R)-3-{[(3R)-3-hydroxybutanoyl]oxy}butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C04546 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6387163 | Reaxys |
| Citations |
|---|