EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H77NO17 |
| Net Charge | 0 |
| Average Mass | 916.112 |
| Monoisotopic Mass | 915.51915 |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H]1CO[C@@H]1O[C@H](C)[C@@H](O)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C46H77NO17/c1-13-33-30(22-58-45-42(57-12)41(56-11)37(52)26(5)60-45)18-23(2)14-15-31(49)24(3)19-29(16-17-48)39(25(4)32(50)20-34(51)62-33)64-44-38(53)36(47(9)10)40(27(6)61-44)63-35-21-46(8,55)43(54)28(7)59-35/h14-15,17-18,24-30,32-33,35-45,50,52-55H,13,16,19-22H2,1-12H3/b15-14+,23-18+/t24-,25+,26-,27-,28+,29+,30-,32-,33-,35+,36-,37-,38-,39-,40-,41-,42-,43+,44+,45-,46-/m1/s1 |
| InChIKey | WBPYTXDJUQJLPQ-VMXQISHHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tylosin (CHEBI:17658) has functional parent tylactone (CHEBI:29700) |
| tylosin (CHEBI:17658) has role allergen (CHEBI:50904) |
| tylosin (CHEBI:17658) has role bacterial metabolite (CHEBI:76969) |
| tylosin (CHEBI:17658) has role environmental contaminant (CHEBI:78298) |
| tylosin (CHEBI:17658) has role xenobiotic (CHEBI:35703) |
| tylosin (CHEBI:17658) is a aldehyde (CHEBI:17478) |
| tylosin (CHEBI:17658) is a disaccharide derivative (CHEBI:63353) |
| tylosin (CHEBI:17658) is a enone (CHEBI:51689) |
| tylosin (CHEBI:17658) is a leucomycin (CHEBI:25022) |
| tylosin (CHEBI:17658) is a macrolide antibiotic (CHEBI:25105) |
| tylosin (CHEBI:17658) is a monosaccharide derivative (CHEBI:63367) |
| tylosin (CHEBI:17658) is conjugate base of tylosin(1+) (CHEBI:77047) |
| Incoming Relation(s) |
| tylosin(1+) (CHEBI:77047) is conjugate acid of tylosin (CHEBI:17658) |
| IUPAC Name |
|---|
| [(2R,3R,4E,6E,9R,11R,12S,13S,14R)-12-[3,6-dideoxy-4-O-(2,6-dideoxy-3-C-methyl-α-L-ribo-hexopyranosyl)-3-(dimethylamino)-β-D-glucopyranosyloxy]-2-ethyl-14-hydroxy-5,9,13-trimethyl-8,16-dioxo-11-(2-oxoethyl)oxacyclohexadeca-4,6-dien-3-yl]methyl 6-deoxy-2,3-di-O-methyl-β-D-allopyranoside |
| INNs | Source |
|---|---|
| tylosin | ChemIDplus |
| tilosina | ChemIDplus |
| tylosine | ChemIDplus |
| tylosinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Tylosin | KEGG COMPOUND |
| Tylan | ChemIDplus |
| Tylocine | ChemIDplus |
| Tylosin A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01457 | KEGG COMPOUND |
| TYK | PDBeChem |
| LMPK04000004 | LIPID MAPS |
| US2004082524 | Patent |
| TYLOSIN | MetaCyc |
| HMDB0034108 | HMDB |
| D02490 | KEGG DRUG |
| Tylosin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4651020 | Reaxys |
| CAS:1401-69-0 | KEGG COMPOUND |
| CAS:1401-69-0 | ChemIDplus |
| Citations |
|---|