EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | CN(CCCC(=O)O)N=O |
| InChI | InChI=1S/C5H10N2O3/c1-7(6-10)4-2-3-5(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | SJLBIPLIGYWGJV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana sp. (ncbitaxon:4094) | - | PubMed (2766465) | Identified in tobacco. |
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (3131281) | Strain: F344 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nitroso-N-methyl-4-aminobutyric acid (CHEBI:176579) has role carcinogenic agent (CHEBI:50903) |
| N-nitroso-N-methyl-4-aminobutyric acid (CHEBI:176579) has role plant metabolite (CHEBI:76924) |
| N-nitroso-N-methyl-4-aminobutyric acid (CHEBI:176579) has role rat metabolite (CHEBI:86264) |
| N-nitroso-N-methyl-4-aminobutyric acid (CHEBI:176579) has role xenobiotic metabolite (CHEBI:76206) |
| N-nitroso-N-methyl-4-aminobutyric acid (CHEBI:176579) is a monocarboxylic acid (CHEBI:25384) |
| N-nitroso-N-methyl-4-aminobutyric acid (CHEBI:176579) is a nitrosamine (CHEBI:35803) |
| IUPAC Name |
|---|
| 4-[methyl(nitroso)amino]butanoic acid |
| Synonyms | Source |
|---|---|
| 4-(N-nitroso-N-methylamino)butyric acid | ChemIDplus |
| 4-(methylnitrosamino)butyric acid | SUBMITTER |
| 4-(methylnitrosoamino)butanoic acid | ChEBI |
| N-methyl-N-(3-carboxypropyl)nitrosamine | ChemIDplus |
| N-nitrosomethyl-3-carboxypropylamine | ChemIDplus |
| N-nitrosomethylaminobutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 39785 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2245230 | Reaxys |
| CAS:61445-55-4 | ChemIDplus |
| Citations |
|---|