EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22O2 |
| Net Charge | 0 |
| Average Mass | 174.284 |
| Monoisotopic Mass | 174.16198 |
| SMILES | CC(O)CCCCCCCCO |
| InChI | InChI=1S/C10H22O2/c1-10(12)8-6-4-2-3-5-7-9-11/h10-12H,2-9H2,1H3 |
| InChIKey | BRBMYNGGGPTKKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (27292630) | Identified in root exudates. Strain: WYJ7 |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. nitrification inhibitor Any inhibitor added to nitrogen fertilizers which can reduce the rate at which ammonium is converted to nitrate. Under appropriate conditions, this can help reduce nitrogen losses through denitrification and leaching. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,9-decanediol (CHEBI:176576) has role nitrification inhibitor (CHEBI:148436) |
| 1,9-decanediol (CHEBI:176576) has role plant metabolite (CHEBI:76924) |
| 1,9-decanediol (CHEBI:176576) is a aliphatic alcohol (CHEBI:2571) |
| 1,9-decanediol (CHEBI:176576) is a diol (CHEBI:23824) |
| 1,9-decanediol (CHEBI:176576) is a primary alcohol (CHEBI:15734) |
| 1,9-decanediol (CHEBI:176576) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| decane-1,9-diol |
| Manual Xrefs | Databases |
|---|---|
| 9085333 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:3208-05-7 | ChEBI |
| Citations |
|---|