EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O3 |
| Net Charge | 0 |
| Average Mass | 180.203 |
| Monoisotopic Mass | 180.07864 |
| SMILES | COC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-3,5-6,11H,4,7H2,1H3 |
| InChIKey | XRAMJHXWXCMGJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | nitrification inhibitor Any inhibitor added to nitrogen fertilizers which can reduce the rate at which ammonium is converted to nitrate. Under appropriate conditions, this can help reduce nitrogen losses through denitrification and leaching. plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) has functional parent phloretic acid (CHEBI:32980) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) has role nitrification inhibitor (CHEBI:148436) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) has role plant growth regulator (CHEBI:26155) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) is a methyl ester (CHEBI:25248) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl 3-(4-hydroxyphenyl)propanoate |
| Synonyms | Source |
|---|---|
| methyl p-hydroxyhydrocinnamate | NIST Chemistry WebBook |
| methyl 3-(p-hydroxyphenyl)propionate | NIST Chemistry WebBook |
| methyl 4-hydroxyhydrocinnamate | NIST Chemistry WebBook |
| 3-(4-hydroxyphenyl)propionic acid methyl ester | NIST Chemistry WebBook |
| 4-hydroxybenzenepropanoic acid methyl ester | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3-(4-hydroxyphenyl)propionic acid methyl ether | UniProt |
| Citations |
|---|