EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O3 |
| Net Charge | 0 |
| Average Mass | 180.203 |
| Monoisotopic Mass | 180.07864 |
| SMILES | COC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-3,5-6,11H,4,7H2,1H3 |
| InChIKey | XRAMJHXWXCMGJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. nitrification inhibitor Any inhibitor added to nitrogen fertilizers which can reduce the rate at which ammonium is converted to nitrate. Under appropriate conditions, this can help reduce nitrogen losses through denitrification and leaching. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) has functional parent phloretic acid (CHEBI:32980) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) has role nitrification inhibitor (CHEBI:148436) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) has role plant growth regulator (CHEBI:26155) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) is a methyl ester (CHEBI:25248) |
| methyl 3-(4-hydroxyphenyl)propionate (CHEBI:176565) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl 3-(4-hydroxyphenyl)propanoate |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxyphenyl)propionic acid methyl ester | NIST Chemistry WebBook |
| 4-hydroxybenzenepropanoic acid methyl ester | ChemIDplus |
| methyl 3-(p-hydroxyphenyl)propionate | NIST Chemistry WebBook |
| methyl 4-hydroxyhydrocinnamate | NIST Chemistry WebBook |
| methyl p-hydroxyhydrocinnamate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 3-(4-hydroxyphenyl)propionic acid methyl ether | UniProt |
| Citations |
|---|