EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13I2NO4 |
| Net Charge | 0 |
| Average Mass | 525.080 |
| Monoisotopic Mass | 524.89340 |
| SMILES | [NH3+][C@@H](Cc1ccc(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H13I2NO4/c16-10-7-9(2-3-13(10)19)22-14-4-1-8(5-11(14)17)6-12(18)15(20)21/h1-5,7,12,19H,6,18H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | CPCJBZABTUOGNM-LBPRGKRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-diiodo-L-thyronine zwitterion (CHEBI:176514) is a amino-acid zwitterion (CHEBI:35238) |
| 3,3'-diiodo-L-thyronine zwitterion (CHEBI:176514) is tautomer of 3,3'-diiodo-L-thyronine (CHEBI:45698) |
| Incoming Relation(s) |
| 3,3'-diiodo-L-thyronine (CHEBI:45698) is tautomer of 3,3'-diiodo-L-thyronine zwitterion (CHEBI:176514) |
| UniProt Name | Source |
|---|---|
| 3,3'-diiodo-L-thyronine | UniProt |