EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8ClNO3 |
| Net Charge | 0 |
| Average Mass | 213.620 |
| Monoisotopic Mass | 213.01927 |
| SMILES | O=C(O)CNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H8ClNO3/c10-7-3-1-2-6(4-7)9(14)11-5-8(12)13/h1-4H,5H2,(H,11,14)(H,12,13) |
| InChIKey | ICYUIIJXZHPESK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-Chloro-hippuric acid (CHEBI:176504) has functional parent N-benzoylglycine (CHEBI:18089) |
| m-Chloro-hippuric acid (CHEBI:176504) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[(3-chlorobenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 435 | ChemSpider |
| HMDB0001309 | HMDB |