EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20Cl2N4O4 |
| Net Charge | 0 |
| Average Mass | 475.332 |
| Monoisotopic Mass | 474.08616 |
| SMILES | Cc1onc(C(=O)N2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20Cl2N4O4/c1-14-20(28(30)31)19(25-32-14)22(29)27-12-10-26(11-13-27)21(15-2-6-17(23)7-3-15)16-4-8-18(24)9-5-16/h2-9,21H,10-13H2,1H3 |
| InChIKey | VIBHJPDPEVVDTB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. EC 1.11.1.9 (glutathione peroxidase) inhibitor An inhibitor of peroxidases (EC 1.11.1.*) that inhibits the action of glutathione peroxidase (EC 1.11.1.9). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML-210 (CHEBI:176502) has role antineoplastic agent (CHEBI:35610) |
| ML-210 (CHEBI:176502) has role EC 1.11.1.9 (glutathione peroxidase) inhibitor (CHEBI:176342) |
| ML-210 (CHEBI:176502) has role ferroptosis inducer (CHEBI:173085) |
| ML-210 (CHEBI:176502) has role prodrug (CHEBI:50266) |
| ML-210 (CHEBI:176502) is a C-nitro compound (CHEBI:35716) |
| ML-210 (CHEBI:176502) is a N-acylpiperazine (CHEBI:46844) |
| ML-210 (CHEBI:176502) is a N-alkylpiperazine (CHEBI:46845) |
| ML-210 (CHEBI:176502) is a diarylmethane (CHEBI:51614) |
| ML-210 (CHEBI:176502) is a isoxazoles (CHEBI:55373) |
| ML-210 (CHEBI:176502) is a monochlorobenzenes (CHEBI:83403) |
| ML-210 (CHEBI:176502) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| {4-[bis(4-chlorophenyl)methyl]piperazin-1-yl}(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone |
| Synonyms | Source |
|---|---|
| [4-[bis(4-chlorophenyl)methyl]-1-piperazinyl](5-methyl-4-nitro-3-isoxazolyl)-methanone | ChEBI |
| DPI10 | ChEBI |
| ML 210 | ChEBI |
| ML210 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 28495222 | ChemSpider |
| LSM-2013 | LINCS |
| US20200138829 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1360705-96-9 | ChEBI |
| Citations |
|---|