EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N5 |
| Net Charge | 0 |
| Average Mass | 323.359 |
| Monoisotopic Mass | 323.11710 |
| SMILES | Cc1ccc(-c2c(C#N)c(N)n3c(nc4ccccc43)c2C#N)cc1 |
| InChI | InChI=1S/C20H13N5/c1-12-6-8-13(9-7-12)18-14(10-21)19(23)25-17-5-3-2-4-16(17)24-20(25)15(18)11-22/h2-9H,23H2,1H3 |
| InChIKey | FNESYDFRCQEEKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | ferroptosis suppressor protein 1 inhibitor An inhibitor which inhibits the action of ferroptosis suppressor protein 1. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iFSP1 (CHEBI:176501) has role antineoplastic agent (CHEBI:35610) |
| iFSP1 (CHEBI:176501) has role ferroptosis inducer (CHEBI:173085) |
| iFSP1 (CHEBI:176501) has role ferroptosis suppressor protein 1 inhibitor (CHEBI:176508) |
| iFSP1 (CHEBI:176501) is a aromatic amine (CHEBI:33860) |
| iFSP1 (CHEBI:176501) is a nitrile (CHEBI:18379) |
| iFSP1 (CHEBI:176501) is a primary amino compound (CHEBI:50994) |
| iFSP1 (CHEBI:176501) is a pyridobenzimidazole (CHEBI:176507) |
| iFSP1 (CHEBI:176501) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 1-amino-3-(4-methylphenyl)pyrido[1,2-a]benzimidazole-2,4-dicarbonitrile |
| Synonyms | Source |
|---|---|
| iFSP-1 | ChEBI |
| 1-amino-3-(p-tolyl)benzo[4,5]imidazo[1,2-a]pyridine-2,4-dicarbonitrile | ChEBI |
| iFSP 1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:150651-39-1 | ChEBI |
| Citations |
|---|